C17H18N2O4S2 — CID 7014423
(2S)-3-(4-ethylphenyl)sulfonyl-2-(4-nitrophenyl)-1,3-thiazolidine (PubChem CID 7014423) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (2S)-3-(4-ethylphenyl)sulfonyl-2-(4-nitrophenyl)-1,3-thiazolidine.
| Compound Name | (2S)-3-(4-ethylphenyl)sulfonyl-2-(4-nitrophenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 7014423 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2S)-3-(4-ethylphenyl)sulfonyl-2-(4-nitrophenyl)-1,3-thiazolidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCS[C@H]2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H18N2O4S2/c1-2-13-3-9-16(10-4-13)25(22,23)18-11-12-24-17(18)14-5-7-15(8-6-14)19(20)21/h3-10,17H,2,11-12H2,1H3/t17-/m0/s1 |
| InChIKey | HNPXGIAKJIRLAN-KRWDZBQOSA-N |
| XLogP | 3.59 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|