C12H13F3N2O4S2 — CID 122329799
2-(4-nitrophenyl)-3-(3,3,3-trifluoropropylsulfonyl)-1,3-thiazolidine (PubChem CID 122329799) has the molecular formula C12H13F3N2O4S2 and a molecular weight of 370.37 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-3-(3,3,3-trifluoropropylsulfonyl)-1,3-thiazolidine.
| Compound Name | 2-(4-nitrophenyl)-3-(3,3,3-trifluoropropylsulfonyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 122329799 |
| Molecular Formula | C12H13F3N2O4S2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 2-(4-nitrophenyl)-3-(3,3,3-trifluoropropylsulfonyl)-1,3-thiazolidine |
| SMILES | O=[N+]([O-])c1ccc(C2SCCN2S(=O)(=O)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O4S2/c13-12(14,15)5-8-23(20,21)16-6-7-22-11(16)9-1-3-10(4-2-9)17(18)19/h1-4,11H,5-8H2 |
| InChIKey | AZNYANFUYAKIEI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|