C17H13F3N2O4S — CID 122329725
[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]-[2-(trifluoromethoxy)phenyl]methanone (PubChem CID 122329725) has the molecular formula C17H13F3N2O4S and a molecular weight of 398.36 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]-[2-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]-[2-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 122329725 |
| Molecular Formula | C17H13F3N2O4S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]-[2-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)F)N1CCSC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13F3N2O4S/c18-17(19,20)26-14-4-2-1-3-13(14)15(23)21-9-10-27-16(21)11-5-7-12(8-6-11)22(24)25/h1-8,16H,9-10H2 |
| InChIKey | JOSCYKYSSGTAKD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|