C16H12F3N3O3S — CID 122329691
2-(4-nitrophenyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazolidine-3-carboxamide (PubChem CID 122329691) has the molecular formula C16H12F3N3O3S and a molecular weight of 383.35 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | 2-(4-nitrophenyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 122329691 |
| Molecular Formula | C16H12F3N3O3S |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 2-(4-nitrophenyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)N1CCSC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12F3N3O3S/c17-11-5-6-12(14(19)13(11)18)20-16(23)21-7-8-26-15(21)9-1-3-10(4-2-9)22(24)25/h1-6,15H,7-8H2,(H,20,23) |
| InChIKey | CIGFBWUGOZIGGN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|