C17H14ClNO3S — CID 748319
2-[(2S)-2-(4-chlorophenyl)-1,3-thiazolidine-3-carbonyl]benzoic acid (PubChem CID 748319) has the molecular formula C17H14ClNO3S and a molecular weight of 347.82 g/mol. Its IUPAC name is 2-[(2S)-2-(4-chlorophenyl)-1,3-thiazolidine-3-carbonyl]benzoic acid.
| Compound Name | 2-[(2S)-2-(4-chlorophenyl)-1,3-thiazolidine-3-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 748319 |
| Molecular Formula | C17H14ClNO3S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-[(2S)-2-(4-chlorophenyl)-1,3-thiazolidine-3-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)N1CCS[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClNO3S/c18-12-7-5-11(6-8-12)16-19(9-10-23-16)15(20)13-3-1-2-4-14(13)17(21)22/h1-8,16H,9-10H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | WBMUDYPJDDBFRN-INIZCTEOSA-N |
| XLogP | 3.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |