C19H20N2O4S — CID 122329734
2-(4-methoxy-3-methylphenyl)-1-[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 122329734) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-(4-methoxy-3-methylphenyl)-1-[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 2-(4-methoxy-3-methylphenyl)-1-[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 122329734 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-(4-methoxy-3-methylphenyl)-1-[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | COc1ccc(CC(=O)N2CCSC2c2ccc([N+](=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C19H20N2O4S/c1-13-11-14(3-8-17(13)25-2)12-18(22)20-9-10-26-19(20)15-4-6-16(7-5-15)21(23)24/h3-8,11,19H,9-10,12H2,1-2H3 |
| InChIKey | FPFKXZGRLYRUHB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|