C16H13N3O4S2 — CID 122329815
4-[[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile (PubChem CID 122329815) has the molecular formula C16H13N3O4S2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-[[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile.
| Compound Name | 4-[[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 122329815 |
| Molecular Formula | C16H13N3O4S2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 4-[[2-(4-nitrophenyl)-1,3-thiazolidin-3-yl]sulfonyl]benzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCSC2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H13N3O4S2/c17-11-12-1-7-15(8-2-12)25(22,23)18-9-10-24-16(18)13-3-5-14(6-4-13)19(20)21/h1-8,16H,9-10H2 |
| InChIKey | ITRWDADDVGJPQK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|