C14H17NO4S — CID 146861544
(4R)-3-butanoyl-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 146861544) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is (4R)-3-butanoyl-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-butanoyl-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 146861544 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (4R)-3-butanoyl-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCC(=O)N1C(c2ccccc2O)SC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H17NO4S/c1-2-5-12(17)15-10(14(18)19)8-20-13(15)9-6-3-4-7-11(9)16/h3-4,6-7,10,13,16H,2,5,8H2,1H3,(H,18,19)/t10-,13?/m0/s1 |
| InChIKey | SKTAVKCNXUCYSB-NKUHCKNESA-N |
| XLogP | 2.22 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|