C22H24N2O6S — CID 70550769
(2R,4R)-3-[2-[[(1S)-1-carboxy-3-phenylpropyl]amino]acetyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 70550769) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is (2R,4R)-3-[2-[[(1S)-1-carboxy-3-phenylpropyl]amino]acetyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-3-[2-[[(1S)-1-carboxy-3-phenylpropyl]amino]acetyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70550769 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (2R,4R)-3-[2-[[(1S)-1-carboxy-3-phenylpropyl]amino]acetyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@H](CCc1ccccc1)NCC(=O)N1[C@@H](c2ccccc2O)SC[C@H]1C(=O)O |
| InChI | InChI=1S/C22H24N2O6S/c25-18-9-5-4-8-15(18)20-24(17(13-31-20)22(29)30)19(26)12-23-16(21(27)28)11-10-14-6-2-1-3-7-14/h1-9,16-17,20,23,25H,10-13H2,(H,27,28)(H,29,30)/t16-,17-,20+/m0/s1 |
| InChIKey | GCLGWVQKQQQFRA-ABSDTBQOSA-N |
| XLogP | 2.10 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|