C27H26N2O7S3 — CID 88694998
(2R,4R)-3-[4-[4-(benzylsulfonylamino)phenyl]-4-oxo-3-sulfanylbutanoyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 88694998) has the molecular formula C27H26N2O7S3 and a molecular weight of 586.71 g/mol. Its IUPAC name is (2R,4R)-3-[4-[4-(benzylsulfonylamino)phenyl]-4-oxo-3-sulfanylbutanoyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4R)-3-[4-[4-(benzylsulfonylamino)phenyl]-4-oxo-3-sulfanylbutanoyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 88694998 |
| Molecular Formula | C27H26N2O7S3 |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | (2R,4R)-3-[4-[4-(benzylsulfonylamino)phenyl]-4-oxo-3-sulfanylbutanoyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(c1ccc(NS(=O)(=O)Cc2ccccc2)cc1)C(S)CC(=O)N1[C@@H](c2ccccc2O)SC[C@H]1C(=O)O |
| InChI | InChI=1S/C27H26N2O7S3/c30-22-9-5-4-8-20(22)26-29(21(15-38-26)27(33)34)24(31)14-23(37)25(32)18-10-12-19(13-11-18)28-39(35,36)16-17-6-2-1-3-7-17/h1-13,21,23,26,28,30,37H,14-16H2,(H,33,34)/t21-,23?,26+/m0/s1 |
| InChIKey | XJJSTNLZJSYEGE-QTJDDQPJSA-N |
| XLogP | 3.93 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|