C25H28N2O6S2 — CID 22825214
2-[[(2R,4R)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 22825214) has the molecular formula C25H28N2O6S2 and a molecular weight of 516.64 g/mol. Its IUPAC name is 2-[[(2R,4R)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2R,4R)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22825214 |
| Molecular Formula | C25H28N2O6S2 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 2-[[(2R,4R)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(=O)SC[C@@H](C)C(=O)N1[C@@H](c2ccccc2O)SC[C@H]1C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H28N2O6S2/c1-15(13-34-16(2)28)23(31)27-20(14-35-24(27)18-10-6-7-11-21(18)29)22(30)26-19(25(32)33)12-17-8-4-3-5-9-17/h3-11,15,19-20,24,29H,12-14H2,1-2H3,(H,26,30)(H,32,33)/t15-,19?,20+,24-/m1/s1 |
| InChIKey | GOTYHPZMWPFLNK-OODMJHNOSA-N |
| XLogP | 3.06 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|