C24H26N2O7S2 — CID 13316873
(2S)-2-[[(2R,4R)-3-(3-acetylsulfanylpropanoyl)-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 13316873) has the molecular formula C24H26N2O7S2 and a molecular weight of 518.61 g/mol. Its IUPAC name is (2S)-2-[[(2R,4R)-3-(3-acetylsulfanylpropanoyl)-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2R,4R)-3-(3-acetylsulfanylpropanoyl)-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 13316873 |
| Molecular Formula | C24H26N2O7S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (2S)-2-[[(2R,4R)-3-(3-acetylsulfanylpropanoyl)-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(=O)SCCC(=O)N1[C@@H](c2ccccc2O)SC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H26N2O7S2/c1-14(27)34-11-10-21(30)26-19(13-35-23(26)17-4-2-3-5-20(17)29)22(31)25-18(24(32)33)12-15-6-8-16(28)9-7-15/h2-9,18-19,23,28-29H,10-13H2,1H3,(H,25,31)(H,32,33)/t18-,19-,23+/m0/s1 |
| InChIKey | ZWYZOITXERAYTN-SFYKDHMMSA-N |
| XLogP | 2.52 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|