C30H30N2O6S — CID 56614807
2-[[(2S)-1-(3-benzoylsulfanylpropanoyl)-5-(2-hydroxyphenyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 56614807) has the molecular formula C30H30N2O6S and a molecular weight of 546.65 g/mol. Its IUPAC name is 2-[[(2S)-1-(3-benzoylsulfanylpropanoyl)-5-(2-hydroxyphenyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[(2S)-1-(3-benzoylsulfanylpropanoyl)-5-(2-hydroxyphenyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 56614807 |
| Molecular Formula | C30H30N2O6S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 2-[[(2S)-1-(3-benzoylsulfanylpropanoyl)-5-(2-hydroxyphenyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(SCCC(=O)N1C(c2ccccc2O)CC[C@H]1C(=O)NC(Cc1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C30H30N2O6S/c33-26-14-8-7-13-22(26)24-15-16-25(28(35)31-23(29(36)37)19-20-9-3-1-4-10-20)32(24)27(34)17-18-39-30(38)21-11-5-2-6-12-21/h1-14,23-25,33H,15-19H2,(H,31,35)(H,36,37)/t23?,24?,25-/m0/s1 |
| InChIKey | MJBQVUZOSVVGLD-STEQJIOHSA-N |
| XLogP | 4.20 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|