C20H22N2O3S — CID 7323787
(2R,4R)-3-acetyl-2-(2-hydroxyphenyl)-N-[(4-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 7323787) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is (2R,4R)-3-acetyl-2-(2-hydroxyphenyl)-N-[(4-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2R,4R)-3-acetyl-2-(2-hydroxyphenyl)-N-[(4-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7323787 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2R,4R)-3-acetyl-2-(2-hydroxyphenyl)-N-[(4-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(=O)N1[C@@H](c2ccccc2O)SC[C@H]1C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-13-7-9-15(10-8-13)11-21-19(25)17-12-26-20(22(17)14(2)23)16-5-3-4-6-18(16)24/h3-10,17,20,24H,11-12H2,1-2H3,(H,21,25)/t17-,20+/m0/s1 |
| InChIKey | PIISJDXTMDICLB-FXAWDEMLSA-N |
| XLogP | 2.98 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|