C17H22N2O3S — CID 7323775
(2R,4R)-3-acetyl-N-cyclopentyl-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 7323775) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is (2R,4R)-3-acetyl-N-cyclopentyl-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (2R,4R)-3-acetyl-N-cyclopentyl-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 7323775 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2R,4R)-3-acetyl-N-cyclopentyl-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(=O)N1[C@@H](c2ccccc2O)SC[C@H]1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H22N2O3S/c1-11(20)19-14(16(22)18-12-6-2-3-7-12)10-23-17(19)13-8-4-5-9-15(13)21/h4-5,8-9,12,14,17,21H,2-3,6-7,10H2,1H3,(H,18,22)/t14-,17+/m0/s1 |
| InChIKey | VFNIRURYDWTBMY-WMLDXEAASA-N |
| XLogP | 2.41 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|