C24H34N2O2S — CID 42744161
N,2-dicyclohexyl-3-(2-methylbenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42744161) has the molecular formula C24H34N2O2S and a molecular weight of 414.62 g/mol. Its IUPAC name is N,2-dicyclohexyl-3-(2-methylbenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N,2-dicyclohexyl-3-(2-methylbenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744161 |
| Molecular Formula | C24H34N2O2S |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N,2-dicyclohexyl-3-(2-methylbenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1C(C(=O)NC2CCCCC2)CSC1C1CCCCC1 |
| InChI | InChI=1S/C24H34N2O2S/c1-17-10-8-9-15-20(17)23(28)26-21(22(27)25-19-13-6-3-7-14-19)16-29-24(26)18-11-4-2-5-12-18/h8-10,15,18-19,21,24H,2-7,11-14,16H2,1H3,(H,25,27) |
| InChIKey | CKWQAYFFNHGXHE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |