C32H36N2O2S — CID 42744164
2-cyclohexyl-N-(1,2-diphenylethyl)-3-(2-methylbenzoyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 42744164) has the molecular formula C32H36N2O2S and a molecular weight of 512.72 g/mol. Its IUPAC name is 2-cyclohexyl-N-(1,2-diphenylethyl)-3-(2-methylbenzoyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-cyclohexyl-N-(1,2-diphenylethyl)-3-(2-methylbenzoyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 42744164 |
| Molecular Formula | C32H36N2O2S |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 2-cyclohexyl-N-(1,2-diphenylethyl)-3-(2-methylbenzoyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1C(C(=O)NC(Cc2ccccc2)c2ccccc2)CSC1C1CCCCC1 |
| InChI | InChI=1S/C32H36N2O2S/c1-23-13-11-12-20-27(23)31(36)34-29(22-37-32(34)26-18-9-4-10-19-26)30(35)33-28(25-16-7-3-8-17-25)21-24-14-5-2-6-15-24/h2-3,5-8,11-17,20,26,28-29,32H,4,9-10,18-19,21-22H2,1H3,(H,33,35) |
| InChIKey | ZAEUOWFXOGECMM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |