C27H25NO4 — CID 54024670
2-[5-(1,2-diphenylethylcarbamoyl)-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid (PubChem CID 54024670) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[5-(1,2-diphenylethylcarbamoyl)-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[5-(1,2-diphenylethylcarbamoyl)-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 54024670 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[5-(1,2-diphenylethylcarbamoyl)-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1cccc2c1CCCC2C(=O)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO4/c29-25(27(31)32)22-15-7-14-21-20(22)13-8-16-23(21)26(30)28-24(19-11-5-2-6-12-19)17-18-9-3-1-4-10-18/h1-7,9-12,14-15,23-24H,8,13,16-17H2,(H,28,30)(H,31,32) |
| InChIKey | LBIHCQLCSRBXKF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|