C20H25N3O — CID 166237644
1-(2-amino-1-cyclopropylethyl)-3-(1,2-diphenylethyl)urea (PubChem CID 166237644) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(2-amino-1-cyclopropylethyl)-3-(1,2-diphenylethyl)urea.
| Compound Name | 1-(2-amino-1-cyclopropylethyl)-3-(1,2-diphenylethyl)urea |
|---|---|
| PubChem CID | 166237644 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-(2-amino-1-cyclopropylethyl)-3-(1,2-diphenylethyl)urea |
| SMILES | NCC(NC(=O)NC(Cc1ccccc1)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C20H25N3O/c21-14-19(17-11-12-17)23-20(24)22-18(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-10,17-19H,11-14,21H2,(H2,22,23,24) |
| InChIKey | CCNMQJWZJJCQCK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |