C13H18N2O2 — CID 95632300
1-[(1R)-1-cyclopropyl-2-phenylethyl]-3-methoxyurea (PubChem CID 95632300) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-[(1R)-1-cyclopropyl-2-phenylethyl]-3-methoxyurea.
| Compound Name | 1-[(1R)-1-cyclopropyl-2-phenylethyl]-3-methoxyurea |
|---|---|
| PubChem CID | 95632300 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-[(1R)-1-cyclopropyl-2-phenylethyl]-3-methoxyurea |
| SMILES | CONC(=O)N[C@H](Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C13H18N2O2/c1-17-15-13(16)14-12(11-7-8-11)9-10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3,(H2,14,15,16)/t12-/m1/s1 |
| InChIKey | XHGOKCIWUONUTN-GFCCVEGCSA-N |
| XLogP | 1.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|