C17H21NO5S2 — CID 163629677
(4R)-3-(3-acetylsulfanyl-2-methylpropanoyl)-2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 163629677) has the molecular formula C17H21NO5S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is (4R)-3-(3-acetylsulfanyl-2-methylpropanoyl)-2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(3-acetylsulfanyl-2-methylpropanoyl)-2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 163629677 |
| Molecular Formula | C17H21NO5S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (4R)-3-(3-acetylsulfanyl-2-methylpropanoyl)-2-(4-methoxyphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1ccc(C2SC[C@@H](C(=O)O)N2C(=O)C(C)CSC(C)=O)cc1 |
| InChI | InChI=1S/C17H21NO5S2/c1-10(8-24-11(2)19)15(20)18-14(17(21)22)9-25-16(18)12-4-6-13(23-3)7-5-12/h4-7,10,14,16H,8-9H2,1-3H3,(H,21,22)/t10?,14-,16?/m0/s1 |
| InChIKey | HUZUUTLWSUNZGF-BHKPVTDMSA-N |
| XLogP | 2.64 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|