C21H21ClN2O6S3 — CID 12767896
(4R)-3-[(2S)-3-(4-chloro-3-sulfamoylbenzoyl)sulfanyl-2-methylpropanoyl]-2-phenyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12767896) has the molecular formula C21H21ClN2O6S3 and a molecular weight of 529.06 g/mol. Its IUPAC name is (4R)-3-[(2S)-3-(4-chloro-3-sulfamoylbenzoyl)sulfanyl-2-methylpropanoyl]-2-phenyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-[(2S)-3-(4-chloro-3-sulfamoylbenzoyl)sulfanyl-2-methylpropanoyl]-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12767896 |
| Molecular Formula | C21H21ClN2O6S3 |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | (4R)-3-[(2S)-3-(4-chloro-3-sulfamoylbenzoyl)sulfanyl-2-methylpropanoyl]-2-phenyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | C[C@H](CSC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)C(=O)N1C(c2ccccc2)SC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H21ClN2O6S3/c1-12(10-32-21(28)14-7-8-15(22)17(9-14)33(23,29)30)18(25)24-16(20(26)27)11-31-19(24)13-5-3-2-4-6-13/h2-9,12,16,19H,10-11H2,1H3,(H,26,27)(H2,23,29,30)/t12-,16+,19?/m1/s1 |
| InChIKey | OVGKUNHTCAPWPG-HNENUHGKSA-N |
| XLogP | 3.22 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|