C16H19ClN2O6S3 — CID 12788335
(4R)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-2-(4-chloro-3-sulfamoylphenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12788335) has the molecular formula C16H19ClN2O6S3 and a molecular weight of 466.99 g/mol. Its IUPAC name is (4R)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-2-(4-chloro-3-sulfamoylphenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-2-(4-chloro-3-sulfamoylphenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12788335 |
| Molecular Formula | C16H19ClN2O6S3 |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | (4R)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-2-(4-chloro-3-sulfamoylphenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)SC[C@@H](C)C(=O)N1C(c2ccc(Cl)c(S(N)(=O)=O)c2)SC[C@H]1C(=O)O |
| InChI | InChI=1S/C16H19ClN2O6S3/c1-8(6-26-9(2)20)14(21)19-12(16(22)23)7-27-15(19)10-3-4-11(17)13(5-10)28(18,24)25/h3-5,8,12,15H,6-7H2,1-2H3,(H,22,23)(H2,18,24,25)/t8-,12+,15?/m1/s1 |
| InChIKey | MZCXUYRNIIEPNW-MFCVOCAASA-N |
| XLogP | 1.93 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|