C15H19NO4S2 — CID 12915769
(4R)-2-(4-methoxyphenyl)-3-[(2S)-2-methyl-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12915769) has the molecular formula C15H19NO4S2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (4R)-2-(4-methoxyphenyl)-3-[(2S)-2-methyl-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-(4-methoxyphenyl)-3-[(2S)-2-methyl-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12915769 |
| Molecular Formula | C15H19NO4S2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (4R)-2-(4-methoxyphenyl)-3-[(2S)-2-methyl-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COc1ccc(C2SC[C@@H](C(=O)O)N2C(=O)[C@H](C)CS)cc1 |
| InChI | InChI=1S/C15H19NO4S2/c1-9(7-21)13(17)16-12(15(18)19)8-22-14(16)10-3-5-11(20-2)6-4-10/h3-6,9,12,14,21H,7-8H2,1-2H3,(H,18,19)/t9-,12+,14?/m1/s1 |
| InChIKey | DQAJYPXRHVIJEC-PBAUEHGMSA-N |
| XLogP | 2.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|