C14H16ClNO4S2 — CID 12915729
(4R)-2-(5-chloro-2-hydroxyphenyl)-3-[(2S)-2-methyl-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12915729) has the molecular formula C14H16ClNO4S2 and a molecular weight of 361.87 g/mol. Its IUPAC name is (4R)-2-(5-chloro-2-hydroxyphenyl)-3-[(2S)-2-methyl-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-(5-chloro-2-hydroxyphenyl)-3-[(2S)-2-methyl-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12915729 |
| Molecular Formula | C14H16ClNO4S2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (4R)-2-(5-chloro-2-hydroxyphenyl)-3-[(2S)-2-methyl-3-sulfanylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | C[C@H](CS)C(=O)N1C(c2cc(Cl)ccc2O)SC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H16ClNO4S2/c1-7(5-21)12(18)16-10(14(19)20)6-22-13(16)9-4-8(15)2-3-11(9)17/h2-4,7,10,13,17,21H,5-6H2,1H3,(H,19,20)/t7-,10+,13?/m1/s1 |
| InChIKey | XSUQPGNLKVDTLX-YNYLGKETSA-N |
| XLogP | 2.64 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|