C19H18ClNO8S — CID 163326917
3-[(5-chloro-2-hydroxyphenyl)methyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid;oxalic acid (PubChem CID 163326917) has the molecular formula C19H18ClNO8S and a molecular weight of 455.87 g/mol. Its IUPAC name is 3-[(5-chloro-2-hydroxyphenyl)methyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid;oxalic acid.
| Compound Name | 3-[(5-chloro-2-hydroxyphenyl)methyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid;oxalic acid |
|---|---|
| PubChem CID | 163326917 |
| Molecular Formula | C19H18ClNO8S |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 3-[(5-chloro-2-hydroxyphenyl)methyl]-2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)C1CSC(c2ccccc2O)N1Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H16ClNO4S.C2H2O4/c18-11-5-6-14(20)10(7-11)8-19-13(17(22)23)9-24-16(19)12-3-1-2-4-15(12)21;3-1(4)2(5)6/h1-7,13,16,20-21H,8-9H2,(H,22,23);(H,3,4)(H,5,6) |
| InChIKey | DEXBARVCYPYEHO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|