C21H20ClNO5S2 — CID 88723158
(4R)-2-(5-chloro-2-hydroxyphenyl)-3-[(2S)-2-methyl-4-oxo-4-phenyl-3-sulfanylbutanoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 88723158) has the molecular formula C21H20ClNO5S2 and a molecular weight of 465.98 g/mol. Its IUPAC name is (4R)-2-(5-chloro-2-hydroxyphenyl)-3-[(2S)-2-methyl-4-oxo-4-phenyl-3-sulfanylbutanoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-2-(5-chloro-2-hydroxyphenyl)-3-[(2S)-2-methyl-4-oxo-4-phenyl-3-sulfanylbutanoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 88723158 |
| Molecular Formula | C21H20ClNO5S2 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | (4R)-2-(5-chloro-2-hydroxyphenyl)-3-[(2S)-2-methyl-4-oxo-4-phenyl-3-sulfanylbutanoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | C[C@@H](C(=O)N1C(c2cc(Cl)ccc2O)SC[C@H]1C(=O)O)C(S)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20ClNO5S2/c1-11(18(29)17(25)12-5-3-2-4-6-12)19(26)23-15(21(27)28)10-30-20(23)14-9-13(22)7-8-16(14)24/h2-9,11,15,18,20,24,29H,10H2,1H3,(H,27,28)/t11-,15+,18?,20?/m1/s1 |
| InChIKey | YZQMZJZCGHJRRH-YFXBPTPGSA-N |
| XLogP | 3.89 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|