C21H25ClN2O3S — CID 3402617
2-(3-chlorophenyl)-3-[[4-(diethylamino)-2-hydroxyphenyl]methyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 3402617) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-[[4-(diethylamino)-2-hydroxyphenyl]methyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-(3-chlorophenyl)-3-[[4-(diethylamino)-2-hydroxyphenyl]methyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3402617 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(3-chlorophenyl)-3-[[4-(diethylamino)-2-hydroxyphenyl]methyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCN(CC)c1ccc(CN2C(C(=O)O)CSC2c2cccc(Cl)c2)c(O)c1 |
| InChI | InChI=1S/C21H25ClN2O3S/c1-3-23(4-2)17-9-8-15(19(25)11-17)12-24-18(21(26)27)13-28-20(24)14-6-5-7-16(22)10-14/h5-11,18,20,25H,3-4,12-13H2,1-2H3,(H,26,27) |
| InChIKey | STKXFLLBSFAPCW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|