C15H19NO4S — CID 88747419
(2S)-4-(2-hydroxyphenyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 88747419) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2S)-4-(2-hydroxyphenyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-(2-hydroxyphenyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88747419 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2S)-4-(2-hydroxyphenyl)-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(CS)C(=O)N1CC(c2ccccc2O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C15H19NO4S/c1-9(8-21)14(18)16-7-10(6-12(16)15(19)20)11-4-2-3-5-13(11)17/h2-5,9-10,12,17,21H,6-8H2,1H3,(H,19,20)/t9?,10?,12-/m0/s1 |
| InChIKey | QWEXBVYOGQEBEU-CBINBANVSA-N |
| XLogP | 1.73 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|