C14H19NO3S2 — CID 88747234
(2S)-1-(2-methyl-3-sulfanylpropanoyl)-4-(thiophen-3-ylmethyl)pyrrolidine-2-carboxylic acid (PubChem CID 88747234) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (2S)-1-(2-methyl-3-sulfanylpropanoyl)-4-(thiophen-3-ylmethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(2-methyl-3-sulfanylpropanoyl)-4-(thiophen-3-ylmethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88747234 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (2S)-1-(2-methyl-3-sulfanylpropanoyl)-4-(thiophen-3-ylmethyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(CS)C(=O)N1CC(Cc2ccsc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C14H19NO3S2/c1-9(7-19)13(16)15-6-11(5-12(15)14(17)18)4-10-2-3-20-8-10/h2-3,8-9,11-12,19H,4-7H2,1H3,(H,17,18)/t9?,11?,12-/m0/s1 |
| InChIKey | GBXVQDXNMLMXEN-NHNAUAITSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|