C12H19NO4S — CID 54259808
(2S,4R)-1-(2-methyl-3-sulfanylpropanoyl)-4-prop-2-enoxypyrrolidine-2-carboxylic acid (PubChem CID 54259808) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is (2S,4R)-1-(2-methyl-3-sulfanylpropanoyl)-4-prop-2-enoxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-(2-methyl-3-sulfanylpropanoyl)-4-prop-2-enoxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54259808 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2S,4R)-1-(2-methyl-3-sulfanylpropanoyl)-4-prop-2-enoxypyrrolidine-2-carboxylic acid |
| SMILES | C=CCO[C@@H]1C[C@@H](C(=O)O)N(C(=O)C(C)CS)C1 |
| InChI | InChI=1S/C12H19NO4S/c1-3-4-17-9-5-10(12(15)16)13(6-9)11(14)8(2)7-18/h3,8-10,18H,1,4-7H2,2H3,(H,15,16)/t8?,9-,10+/m1/s1 |
| InChIKey | RCRPJLQOBNTHRZ-XVBQNVSMSA-N |
| XLogP | 0.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|