C10H14F3NO4S — CID 54204753
(2S,4S)-4-methoxy-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54204753) has the molecular formula C10H14F3NO4S and a molecular weight of 301.29 g/mol. Its IUPAC name is (2S,4S)-4-methoxy-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-methoxy-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54204753 |
| Molecular Formula | C10H14F3NO4S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | (2S,4S)-4-methoxy-1-[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CO[C@H]1C[C@@H](C(=O)O)N(C(=O)C(CS)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F3NO4S/c1-18-5-2-7(9(16)17)14(3-5)8(15)6(4-19)10(11,12)13/h5-7,19H,2-4H2,1H3,(H,16,17)/t5-,6?,7-/m0/s1 |
| InChIKey | PRSJMFCBDPYKAK-LOJRBXKRSA-N |
| XLogP | 0.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|