C11H19NO4S — CID 22819396
(2R,4S)-4-methoxy-1-[2-(sulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 22819396) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is (2R,4S)-4-methoxy-1-[2-(sulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-methoxy-1-[2-(sulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22819396 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (2R,4S)-4-methoxy-1-[2-(sulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCC(CS)C(=O)N1C[C@@H](OC)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H19NO4S/c1-3-7(6-17)10(13)12-5-8(16-2)4-9(12)11(14)15/h7-9,17H,3-6H2,1-2H3,(H,14,15)/t7?,8-,9+/m0/s1 |
| InChIKey | TYZFTUKCESTPKK-SXNZSPLWSA-N |
| XLogP | 0.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|