C10H15NO4S — CID 57127150
(2S)-4-oxo-1-[2-(sulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 57127150) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is (2S)-4-oxo-1-[2-(sulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-oxo-1-[2-(sulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 57127150 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (2S)-4-oxo-1-[2-(sulfanylmethyl)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCC(CS)C(=O)N1CC(=O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C10H15NO4S/c1-2-6(5-16)9(13)11-4-7(12)3-8(11)10(14)15/h6,8,16H,2-5H2,1H3,(H,14,15)/t6?,8-/m0/s1 |
| InChIKey | GXKPSKZYTWVNHS-XDKWHASVSA-N |
| XLogP | 0.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|