C9H13NO4S — CID 131712511
methyl (2S)-4-oxo-1-(3-sulfanylpropanoyl)pyrrolidine-2-carboxylate (PubChem CID 131712511) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is methyl (2S)-4-oxo-1-(3-sulfanylpropanoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-4-oxo-1-(3-sulfanylpropanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 131712511 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | methyl (2S)-4-oxo-1-(3-sulfanylpropanoyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)CN1C(=O)CCS |
| InChI | InChI=1S/C9H13NO4S/c1-14-9(13)7-4-6(11)5-10(7)8(12)2-3-15/h7,15H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | IGIUMEWZFRCOGJ-ZETCQYMHSA-N |
| XLogP | -0.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|