C14H17NO5S2 — CID 13406882
6,7-dihydroxy-2-[3-sulfanyl-2-(sulfanylmethyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 13406882) has the molecular formula C14H17NO5S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6,7-dihydroxy-2-[3-sulfanyl-2-(sulfanylmethyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 6,7-dihydroxy-2-[3-sulfanyl-2-(sulfanylmethyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 13406882 |
| Molecular Formula | C14H17NO5S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 6,7-dihydroxy-2-[3-sulfanyl-2-(sulfanylmethyl)propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(O)c(O)cc2CN1C(=O)C(CS)CS |
| InChI | InChI=1S/C14H17NO5S2/c16-11-2-7-1-10(14(19)20)15(4-8(7)3-12(11)17)13(18)9(5-21)6-22/h2-3,9-10,16-17,21-22H,1,4-6H2,(H,19,20) |
| InChIKey | OYQRHNXLUWRWPP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|