C9H15NO4S2 — CID 54446470
(2S)-4-hydroxy-1-[3-sulfanyl-2-(sulfanylmethyl)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54446470) has the molecular formula C9H15NO4S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is (2S)-4-hydroxy-1-[3-sulfanyl-2-(sulfanylmethyl)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-hydroxy-1-[3-sulfanyl-2-(sulfanylmethyl)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54446470 |
| Molecular Formula | C9H15NO4S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | (2S)-4-hydroxy-1-[3-sulfanyl-2-(sulfanylmethyl)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(O)CN1C(=O)C(CS)CS |
| InChI | InChI=1S/C9H15NO4S2/c11-6-1-7(9(13)14)10(2-6)8(12)5(3-15)4-16/h5-7,11,15-16H,1-4H2,(H,13,14)/t6?,7-/m0/s1 |
| InChIKey | WRWFETNZRULPRG-MLWJPKLSSA-N |
| XLogP | -0.49 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|