C9H15NO3S2 — CID 14036345
(2S,4S)-1-(2-methyl-3-sulfanylpropanoyl)-4-sulfanylpyrrolidine-2-carboxylic acid (PubChem CID 14036345) has the molecular formula C9H15NO3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is (2S,4S)-1-(2-methyl-3-sulfanylpropanoyl)-4-sulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(2-methyl-3-sulfanylpropanoyl)-4-sulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14036345 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | (2S,4S)-1-(2-methyl-3-sulfanylpropanoyl)-4-sulfanylpyrrolidine-2-carboxylic acid |
| SMILES | CC(CS)C(=O)N1C[C@@H](S)C[C@H]1C(=O)O |
| InChI | InChI=1S/C9H15NO3S2/c1-5(4-14)8(11)10-3-6(15)2-7(10)9(12)13/h5-7,14-15H,2-4H2,1H3,(H,12,13)/t5?,6-,7-/m0/s1 |
| InChIKey | JDLCETAAUWKWLA-BYRXKDITSA-N |
| XLogP | 0.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|