(2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid

C13H15NO4 — CID 170165254

IUPAC(2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid
SMILESCc1ccccc1[C@H]1C[C@@H](C(=O)O)N(C(=O)O)C1
InChIInChI=1S/C13H15NO4/c1-8-4-2-3-5-10(8)9-6-11(12(15)16)14(7-9)13(17)18/h2-5,9,11H,6-7H2,1H3,(H,15,16)(H,17,18)/t9-,11-/m0/s1
InChIKeyCPNQBNPCSMXEMP-ONGXEEELSA-N
MW249.27 g/mol
LogP1.92
Rot. Bonds2

About (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid

(2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 170165254) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid.

Molecular Properties

Compound Name(2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid
PubChem CID170165254
Molecular FormulaC13H15NO4
Molecular Weight249.27 g/mol
Exact Mass249.10
IUPAC Name(2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid
SMILESCc1ccccc1[C@H]1C[C@@H](C(=O)O)N(C(=O)O)C1
InChIInChI=1S/C13H15NO4/c1-8-4-2-3-5-10(8)9-6-11(12(15)16)14(7-9)13(17)18/h2-5,9,11H,6-7H2,1H3,(H,15,16)(H,17,18)/t9-,11-/m0/s1
InChIKeyCPNQBNPCSMXEMP-ONGXEEELSA-N
XLogP1.92
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.27
LogP ≤ 51.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid (CID 170165254) is (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid is Cc1ccccc1[C@H]1C[C@@H](C(=O)O)N(C(=O)O)C1.
What is the InChIKey of (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid?
The InChIKey is CPNQBNPCSMXEMP-ONGXEEELSA-N. The full InChI is InChI=1S/C13H15NO4/c1-8-4-2-3-5-10(8)9-6-11(12(15)16)14(7-9)13(17)18/h2-5,9,11H,6-7H2,1H3,(H,15,16)(H,17,18)/t9-,11-/m0/s1.
What are the key properties of (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid?
(2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid has a molecular weight of 249.27 g/mol, XLogP of 1.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-4-(2-methylphenyl)pyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 170165254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).