About (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid
(2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 151065309) has the molecular formula C11H12N2O4
and a molecular weight of 236.23 g/mol. Its IUPAC name is (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid |
| PubChem CID | 151065309 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1CC(c2ccccn2)CN1C(=O)O |
| InChI | InChI=1S/C11H12N2O4/c14-10(15)9-5-7(6-13(9)11(16)17)8-3-1-2-4-12-8/h1-4,7,9H,5-6H2,(H,14,15)(H,16,17)/t7?,9-/m1/s1 |
| InChIKey | MGZYCAIKRKQOQW-NHSZFOGYSA-N |
| XLogP | 1.00 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid (CID 151065309) is (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid is O=C(O)[C@H]1CC(c2ccccn2)CN1C(=O)O.
What is the InChIKey of (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid?
The InChIKey is MGZYCAIKRKQOQW-NHSZFOGYSA-N. The full InChI is InChI=1S/C11H12N2O4/c14-10(15)9-5-7(6-13(9)11(16)17)8-3-1-2-4-12-8/h1-4,7,9H,5-6H2,(H,14,15)(H,16,17)/t7?,9-/m1/s1.
What are the key properties of (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid?
(2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid has a molecular weight of 236.23 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-pyridin-2-ylpyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 151065309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).