C16H16N2O5 — CID 148566227
4-(quinolin-8-ylmethoxy)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 148566227) has the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-(quinolin-8-ylmethoxy)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | 4-(quinolin-8-ylmethoxy)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 148566227 |
| Molecular Formula | C16H16N2O5 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-(quinolin-8-ylmethoxy)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CC(OCc2cccc3cccnc23)CN1C(=O)O |
| InChI | InChI=1S/C16H16N2O5/c19-15(20)13-7-12(8-18(13)16(21)22)23-9-11-4-1-3-10-5-2-6-17-14(10)11/h1-6,12-13H,7-9H2,(H,19,20)(H,21,22) |
| InChIKey | MVZCRXMSNNRCOO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |