C17H18N4O6 — CID 87787281
4-[2-(hydroxyamino)-2-oxoethoxy]-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylic acid (PubChem CID 87787281) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is 4-[2-(hydroxyamino)-2-oxoethoxy]-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 4-[2-(hydroxyamino)-2-oxoethoxy]-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87787281 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-[2-(hydroxyamino)-2-oxoethoxy]-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(COC1CC(C(=O)Nc2cccc3cccnc23)N(C(=O)O)C1)NO |
| InChI | InChI=1S/C17H18N4O6/c22-14(20-26)9-27-11-7-13(21(8-11)17(24)25)16(23)19-12-5-1-3-10-4-2-6-18-15(10)12/h1-6,11,13,26H,7-9H2,(H,19,23)(H,20,22)(H,24,25) |
| InChIKey | ZDWKAYSCEWMTAS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|