C15H14N6O3 — CID 91581147
4-azido-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylic acid (PubChem CID 91581147) has the molecular formula C15H14N6O3 and a molecular weight of 326.32 g/mol. Its IUPAC name is 4-azido-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 4-azido-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 91581147 |
| Molecular Formula | C15H14N6O3 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-azido-2-(quinolin-8-ylcarbamoyl)pyrrolidine-1-carboxylic acid |
| SMILES | [N-]=[N+]=NC1CC(C(=O)Nc2cccc3cccnc23)N(C(=O)O)C1 |
| InChI | InChI=1S/C15H14N6O3/c16-20-19-10-7-12(21(8-10)15(23)24)14(22)18-11-5-1-3-9-4-2-6-17-13(9)11/h1-6,10,12H,7-8H2,(H,18,22)(H,23,24) |
| InChIKey | MRYXXHJAJFMOST-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|