C19H19N5O4 — CID 120534404
4-methoxy-1-(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 120534404) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 4-methoxy-1-(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-methoxy-1-(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 120534404 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-methoxy-1-(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | COC1CC(C(=O)O)N(C(=O)c2nnn(-c3cccc4cccnc34)c2C)C1 |
| InChI | InChI=1S/C19H19N5O4/c1-11-16(18(25)23-10-13(28-2)9-15(23)19(26)27)21-22-24(11)14-7-3-5-12-6-4-8-20-17(12)14/h3-8,13,15H,9-10H2,1-2H3,(H,26,27) |
| InChIKey | UGQIJOKGIZDBGN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |