C19H21N5O3 — CID 120516941
2-methyl-2-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]pentanoic acid (PubChem CID 120516941) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-methyl-2-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]pentanoic acid.
| Compound Name | 2-methyl-2-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 120516941 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-methyl-2-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]pentanoic acid |
| SMILES | CCCC(C)(NC(=O)c1nnn(-c2cccc3cccnc23)c1C)C(=O)O |
| InChI | InChI=1S/C19H21N5O3/c1-4-10-19(3,18(26)27)21-17(25)15-12(2)24(23-22-15)14-9-5-7-13-8-6-11-20-16(13)14/h5-9,11H,4,10H2,1-3H3,(H,21,25)(H,26,27) |
| InChIKey | YMARAHBDVQXSQS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |