C19H26Cl2N6O — CID 119666236
N-(1-aminohexan-2-yl)-5-methyl-1-quinolin-8-yltriazole-4-carboxamide;dihydrochloride (PubChem CID 119666236) has the molecular formula C19H26Cl2N6O and a molecular weight of 425.36 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-5-methyl-1-quinolin-8-yltriazole-4-carboxamide;dihydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-5-methyl-1-quinolin-8-yltriazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119666236 |
| Molecular Formula | C19H26Cl2N6O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-5-methyl-1-quinolin-8-yltriazole-4-carboxamide;dihydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1nnn(-c2cccc3cccnc23)c1C.Cl.Cl |
| InChI | InChI=1S/C19H24N6O.2ClH/c1-3-4-9-15(12-20)22-19(26)17-13(2)25(24-23-17)16-10-5-7-14-8-6-11-21-18(14)16;;/h5-8,10-11,15H,3-4,9,12,20H2,1-2H3,(H,22,26);2*1H |
| InChIKey | IHUZNLIRFSYLLF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |