C20H24N6O — CID 167875096
5-methyl-N-(1-piperidin-3-ylethyl)-1-quinolin-8-yltriazole-4-carboxamide (PubChem CID 167875096) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-methyl-N-(1-piperidin-3-ylethyl)-1-quinolin-8-yltriazole-4-carboxamide.
| Compound Name | 5-methyl-N-(1-piperidin-3-ylethyl)-1-quinolin-8-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 167875096 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 5-methyl-N-(1-piperidin-3-ylethyl)-1-quinolin-8-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)C2CCCNC2)nnn1-c1cccc2cccnc12 |
| InChI | InChI=1S/C20H24N6O/c1-13(16-8-4-10-21-12-16)23-20(27)18-14(2)26(25-24-18)17-9-3-6-15-7-5-11-22-19(15)17/h3,5-7,9,11,13,16,21H,4,8,10,12H2,1-2H3,(H,23,27) |
| InChIKey | HONLYIAZBRQVGW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |