C18H19N5O3 — CID 120518470
2-methyl-2-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]butanoic acid (PubChem CID 120518470) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-methyl-2-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]butanoic acid.
| Compound Name | 2-methyl-2-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120518470 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-methyl-2-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]butanoic acid |
| SMILES | CCC(C)(NC(=O)c1nnn(-c2cccc3cccnc23)c1C)C(=O)O |
| InChI | InChI=1S/C18H19N5O3/c1-4-18(3,17(25)26)20-16(24)14-11(2)23(22-21-14)13-9-5-7-12-8-6-10-19-15(12)13/h5-10H,4H2,1-3H3,(H,20,24)(H,25,26) |
| InChIKey | SAGGTZLSCOQOKN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |