C19H19N5O3 — CID 120521955
2-[1-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]cyclobutyl]acetic acid (PubChem CID 120521955) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-[1-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 120521955 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[1-[(5-methyl-1-quinolin-8-yltriazole-4-carbonyl)amino]cyclobutyl]acetic acid |
| SMILES | Cc1c(C(=O)NC2(CC(=O)O)CCC2)nnn1-c1cccc2cccnc12 |
| InChI | InChI=1S/C19H19N5O3/c1-12-16(18(27)21-19(8-4-9-19)11-15(25)26)22-23-24(12)14-7-2-5-13-6-3-10-20-17(13)14/h2-3,5-7,10H,4,8-9,11H2,1H3,(H,21,27)(H,25,26) |
| InChIKey | OZBDRFLCBCXCHX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |