C18H17N5O3 — CID 120530849
1-[(5-methyl-1-quinolin-5-yltriazole-4-carbonyl)amino]cyclobutane-1-carboxylic acid (PubChem CID 120530849) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-[(5-methyl-1-quinolin-5-yltriazole-4-carbonyl)amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(5-methyl-1-quinolin-5-yltriazole-4-carbonyl)amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 120530849 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-[(5-methyl-1-quinolin-5-yltriazole-4-carbonyl)amino]cyclobutane-1-carboxylic acid |
| SMILES | Cc1c(C(=O)NC2(C(=O)O)CCC2)nnn1-c1cccc2ncccc12 |
| InChI | InChI=1S/C18H17N5O3/c1-11-15(16(24)20-18(17(25)26)8-4-9-18)21-22-23(11)14-7-2-6-13-12(14)5-3-10-19-13/h2-3,5-7,10H,4,8-9H2,1H3,(H,20,24)(H,25,26) |
| InChIKey | VQULRSXIOAONPV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |